C22H18BrN7O4S2 — CID 4152186
N-[[4-(4-bromophenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide (PubChem CID 4152186) has the molecular formula C22H18BrN7O4S2 and a molecular weight of 588.47 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[4-(4-bromophenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4152186 |
| Molecular Formula | C22H18BrN7O4S2 |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 587.00 |
| IUPAC Name | N-[[4-(4-bromophenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NCc2nnc(SCC(=O)Nc3nccs3)n2-c2ccc(Br)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18BrN7O4S2/c1-13-2-3-14(10-17(13)30(33)34)20(32)25-11-18-27-28-22(29(18)16-6-4-15(23)5-7-16)36-12-19(31)26-21-24-8-9-35-21/h2-10H,11-12H2,1H3,(H,25,32)(H,24,26,31) |
| InChIKey | VTEBDLRUNGOUMA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|