C22H19BrN8O4S2 — CID 44911246
N-[[4-(4-bromophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide (PubChem CID 44911246) has the molecular formula C22H19BrN8O4S2 and a molecular weight of 603.48 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[4-(4-bromophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 44911246 |
| Molecular Formula | C22H19BrN8O4S2 |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 602.02 |
| IUPAC Name | N-[[4-(4-bromophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1nnc(NC(=O)CSc2nnc(CNC(=O)c3ccc(C)c([N+](=O)[O-])c3)n2-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C22H19BrN8O4S2/c1-12-3-4-14(9-17(12)31(34)35)20(33)24-10-18-27-29-22(30(18)16-7-5-15(23)6-8-16)36-11-19(32)25-21-28-26-13(2)37-21/h3-9H,10-11H2,1-2H3,(H,24,33)(H,25,28,32) |
| InChIKey | YTZMTOCBZMDXGV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 157.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|