C28H28N6O5S — CID 44912877
N-[[4-(4-ethoxyphenyl)-5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide (PubChem CID 44912877) has the molecular formula C28H28N6O5S and a molecular weight of 560.64 g/mol. Its IUPAC name is N-[[4-(4-ethoxyphenyl)-5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[4-(4-ethoxyphenyl)-5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 44912877 |
| Molecular Formula | C28H28N6O5S |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | N-[[4-(4-ethoxyphenyl)-5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCOc1ccc(-n2c(CNC(=O)c3ccc(C)c([N+](=O)[O-])c3)nnc2SCC(=O)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C28H28N6O5S/c1-4-39-23-12-10-22(11-13-23)33-25(16-29-27(36)20-9-8-19(3)24(15-20)34(37)38)31-32-28(33)40-17-26(35)30-21-7-5-6-18(2)14-21/h5-15H,4,16-17H2,1-3H3,(H,29,36)(H,30,35) |
| InChIKey | QIKYMQPVKCMXPU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|