C28H28N6O6S — CID 23990597
N-[[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide (PubChem CID 23990597) has the molecular formula C28H28N6O6S and a molecular weight of 576.64 g/mol. Its IUPAC name is N-[[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 23990597 |
| Molecular Formula | C28H28N6O6S |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | N-[[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(CNC(=O)c3ccc(C)c([N+](=O)[O-])c3)n2-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C28H28N6O6S/c1-4-40-21-13-11-20(12-14-21)30-26(35)17-41-28-32-31-25(33(28)22-7-5-6-8-24(22)39-3)16-29-27(36)19-10-9-18(2)23(15-19)34(37)38/h5-15H,4,16-17H2,1-3H3,(H,29,36)(H,30,35) |
| InChIKey | HPHYQXAIJJBOFB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|