C30H30N6O5S — CID 44912884
N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide (PubChem CID 44912884) has the molecular formula C30H30N6O5S and a molecular weight of 586.67 g/mol. Its IUPAC name is N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 44912884 |
| Molecular Formula | C30H30N6O5S |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCOc1ccc(-n2c(CNC(=O)c3ccc(C)c([N+](=O)[O-])c3)nnc2SCC(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C30H30N6O5S/c1-3-41-24-14-12-23(13-15-24)35-27(18-31-29(38)22-11-10-20(2)26(17-22)36(39)40)32-33-30(35)42-19-28(37)34-16-6-8-21-7-4-5-9-25(21)34/h4-5,7,9-15,17H,3,6,8,16,18-19H2,1-2H3,(H,31,38) |
| InChIKey | KDPOPVPNJFDOKW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|