C31H33N5O2S — CID 44912823
N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide (PubChem CID 44912823) has the molecular formula C31H33N5O2S and a molecular weight of 539.71 g/mol. Its IUPAC name is N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide.
| Compound Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 44912823 |
| Molecular Formula | C31H33N5O2S |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2nnc(SCC(=O)N3CCCc4ccccc43)n2-c2cccc(C)c2C)cc1C |
| InChI | InChI=1S/C31H33N5O2S/c1-20-14-15-25(17-22(20)3)30(38)32-18-28-33-34-31(36(28)26-13-7-9-21(2)23(26)4)39-19-29(37)35-16-8-11-24-10-5-6-12-27(24)35/h5-7,9-10,12-15,17H,8,11,16,18-19H2,1-4H3,(H,32,38) |
| InChIKey | LIHROQUONJCYJK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |