C34H36F3N5O5S — CID 44911531
N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide (PubChem CID 44911531) has the molecular formula C34H36F3N5O5S and a molecular weight of 683.75 g/mol. Its IUPAC name is N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 44911531 |
| Molecular Formula | C34H36F3N5O5S |
| Molecular Weight | 683.75 g/mol |
| Exact Mass | 683.24 |
| IUPAC Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2nnc(SCC(=O)N3CCCc4ccccc43)n2-c2cccc(C(F)(F)F)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C34H36F3N5O5S/c1-4-45-27-17-23(18-28(46-5-2)31(27)47-6-3)32(44)38-20-29-39-40-33(42(29)25-14-9-13-24(19-25)34(35,36)37)48-21-30(43)41-16-10-12-22-11-7-8-15-26(22)41/h7-9,11,13-15,17-19H,4-6,10,12,16,20-21H2,1-3H3,(H,38,44) |
| InChIKey | POVARXYVMGVJIO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |