C33H37N5O5S — CID 44911462
N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide (PubChem CID 44911462) has the molecular formula C33H37N5O5S and a molecular weight of 615.76 g/mol. Its IUPAC name is N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 44911462 |
| Molecular Formula | C33H37N5O5S |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | N-[[5-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2nnc(SCC(=O)N3CCCc4ccccc43)n2-c2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C33H37N5O5S/c1-4-41-27-19-24(20-28(42-5-2)31(27)43-6-3)32(40)34-21-29-35-36-33(38(29)25-15-8-7-9-16-25)44-22-30(39)37-18-12-14-23-13-10-11-17-26(23)37/h7-11,13,15-17,19-20H,4-6,12,14,18,21-22H2,1-3H3,(H,34,40) |
| InChIKey | WMZJJTWLGBWHMX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |