C32H34N6O7S2 — CID 5067365
ethyl 2-[[2-[[4-(2-methoxyphenyl)-5-[[(4-methyl-3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 5067365) has the molecular formula C32H34N6O7S2 and a molecular weight of 678.79 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-(2-methoxyphenyl)-5-[[(4-methyl-3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-(2-methoxyphenyl)-5-[[(4-methyl-3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5067365 |
| Molecular Formula | C32H34N6O7S2 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | ethyl 2-[[2-[[4-(2-methoxyphenyl)-5-[[(4-methyl-3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(CNC(=O)c3ccc(C)c([N+](=O)[O-])c3)n2-c2ccccc2OC)sc2c1CCCCC2 |
| InChI | InChI=1S/C32H34N6O7S2/c1-4-45-31(41)28-21-10-6-5-7-13-25(21)47-30(28)34-27(39)18-46-32-36-35-26(37(32)22-11-8-9-12-24(22)44-3)17-33-29(40)20-15-14-19(2)23(16-20)38(42)43/h8-9,11-12,14-16H,4-7,10,13,17-18H2,1-3H3,(H,33,40)(H,34,39) |
| InChIKey | KFJULNHGRBFALI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 167.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|