C35H41N5O9S — CID 44913138
ethyl 4-[[2-[[4-(2,5-dimethoxyphenyl)-5-[[(3,4,5-triethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 44913138) has the molecular formula C35H41N5O9S and a molecular weight of 707.81 g/mol. Its IUPAC name is ethyl 4-[[2-[[4-(2,5-dimethoxyphenyl)-5-[[(3,4,5-triethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[[4-(2,5-dimethoxyphenyl)-5-[[(3,4,5-triethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 44913138 |
| Molecular Formula | C35H41N5O9S |
| Molecular Weight | 707.81 g/mol |
| Exact Mass | 707.26 |
| IUPAC Name | ethyl 4-[[2-[[4-(2,5-dimethoxyphenyl)-5-[[(3,4,5-triethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nnc(CNC(=O)c3cc(OCC)c(OCC)c(OCC)c3)n2-c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C35H41N5O9S/c1-7-46-28-17-23(18-29(47-8-2)32(28)48-9-3)33(42)36-20-30-38-39-35(40(30)26-19-25(44-5)15-16-27(26)45-6)50-21-31(41)37-24-13-11-22(12-14-24)34(43)49-10-4/h11-19H,7-10,20-21H2,1-6H3,(H,36,42)(H,37,41) |
| InChIKey | XZZGBQZCPYHAES-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |