C26H26N6O4S — CID 1157057
2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 1157057) has the molecular formula C26H26N6O4S and a molecular weight of 518.60 g/mol. Its IUPAC name is 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1157057 |
| Molecular Formula | C26H26N6O4S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | CCOc1ccc(NCc2nnc(SCC(=O)Nc3ccc(C)c([N+](=O)[O-])c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N6O4S/c1-3-36-22-13-11-19(12-14-22)27-16-24-29-30-26(31(24)21-7-5-4-6-8-21)37-17-25(33)28-20-10-9-18(2)23(15-20)32(34)35/h4-15,27H,3,16-17H2,1-2H3,(H,28,33) |
| InChIKey | PQNKIKRJMYCRSO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|