C21H24N4O3S — CID 1207068
ethyl 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 1207068) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is ethyl 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 1207068 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | ethyl 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(CNc2ccc(OCC)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H24N4O3S/c1-3-27-18-12-10-16(11-13-18)22-14-19-23-24-21(29-15-20(26)28-4-2)25(19)17-8-6-5-7-9-17/h5-13,22H,3-4,14-15H2,1-2H3 |
| InChIKey | ZRSKZPDQUBLAHD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|