C20H19Cl2N5O3S — CID 124548647
3,4-dichloro-N-[(1R)-1-[4-ethyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 124548647) has the molecular formula C20H19Cl2N5O3S and a molecular weight of 480.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[(1R)-1-[4-ethyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(1R)-1-[4-ethyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 124548647 |
| Molecular Formula | C20H19Cl2N5O3S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 3,4-dichloro-N-[(1R)-1-[4-ethyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | CCn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1[C@@H](C)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N5O3S/c1-3-26-18(12(2)23-19(28)14-6-9-16(21)17(22)10-14)24-25-20(26)31-11-13-4-7-15(8-5-13)27(29)30/h4-10,12H,3,11H2,1-2H3,(H,23,28)/t12-/m1/s1 |
| InChIKey | NVXKSHNAJMMBEQ-GFCCVEGCSA-N |
| XLogP | 5.30 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|