C24H22ClN5O4S2 — CID 42747171
N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzenesulfonamide (PubChem CID 42747171) has the molecular formula C24H22ClN5O4S2 and a molecular weight of 544.06 g/mol. Its IUPAC name is N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42747171 |
| Molecular Formula | C24H22ClN5O4S2 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1cccc(CSc2nnc(CNS(=O)(=O)c3ccc([N+](=O)[O-])cc3)n2-c2cc(Cl)ccc2C)c1 |
| InChI | InChI=1S/C24H22ClN5O4S2/c1-16-4-3-5-18(12-16)15-35-24-28-27-23(29(24)22-13-19(25)7-6-17(22)2)14-26-36(33,34)21-10-8-20(9-11-21)30(31)32/h3-13,26H,14-15H2,1-2H3 |
| InChIKey | GLWFACKDBPUEKU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|