C23H19ClN4O2S — CID 2419849
3-(3-chlorophenyl)-4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 2419849) has the molecular formula C23H19ClN4O2S and a molecular weight of 450.95 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-(3-chlorophenyl)-4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 2419849 |
| Molecular Formula | C23H19ClN4O2S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3-(3-chlorophenyl)-4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | Cc1ccc(C)c(-n2c(SCc3ccc([N+](=O)[O-])cc3)nnc2-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H19ClN4O2S/c1-15-6-7-16(2)21(12-15)27-22(18-4-3-5-19(24)13-18)25-26-23(27)31-14-17-8-10-20(11-9-17)28(29)30/h3-13H,14H2,1-2H3 |
| InChIKey | DALOYYUOHGHGJH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|