C16H13ClN4O2S — CID 1123980
3-[(4-chlorophenyl)methylsulfanyl]-4-methyl-5-(4-nitrophenyl)-1,2,4-triazole (PubChem CID 1123980) has the molecular formula C16H13ClN4O2S and a molecular weight of 360.83 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfanyl]-4-methyl-5-(4-nitrophenyl)-1,2,4-triazole.
| Compound Name | 3-[(4-chlorophenyl)methylsulfanyl]-4-methyl-5-(4-nitrophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 1123980 |
| Molecular Formula | C16H13ClN4O2S |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfanyl]-4-methyl-5-(4-nitrophenyl)-1,2,4-triazole |
| SMILES | Cn1c(SCc2ccc(Cl)cc2)nnc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13ClN4O2S/c1-20-15(12-4-8-14(9-5-12)21(22)23)18-19-16(20)24-10-11-2-6-13(17)7-3-11/h2-9H,10H2,1H3 |
| InChIKey | KBASUEWLZFENEP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|