C20H21ClN4O2S — CID 10070562
3-butyl-5-[(4-chlorophenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole (PubChem CID 10070562) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is 3-butyl-5-[(4-chlorophenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole.
| Compound Name | 3-butyl-5-[(4-chlorophenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 10070562 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-butyl-5-[(4-chlorophenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole |
| SMILES | CCCCc1nnc(SCc2ccc(Cl)cc2)n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21ClN4O2S/c1-2-3-4-19-22-23-20(28-14-16-5-9-17(21)10-6-16)24(19)13-15-7-11-18(12-8-15)25(26)27/h5-12H,2-4,13-14H2,1H3 |
| InChIKey | GTCNGRXSTDUFRH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|