C35H32N8O4S2 — CID 14661721
3-[(4-nitrophenyl)methylsulfanyl]-5-[5-[5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pentyl]-4-phenyl-1,2,4-triazole (PubChem CID 14661721) has the molecular formula C35H32N8O4S2 and a molecular weight of 692.83 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methylsulfanyl]-5-[5-[5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pentyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-[(4-nitrophenyl)methylsulfanyl]-5-[5-[5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pentyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 14661721 |
| Molecular Formula | C35H32N8O4S2 |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.20 |
| IUPAC Name | 3-[(4-nitrophenyl)methylsulfanyl]-5-[5-[5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pentyl]-4-phenyl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccc(CSc2nnc(CCCCCc3nnc(SCc4ccc([N+](=O)[O-])cc4)n3-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H32N8O4S2/c44-42(45)30-20-16-26(17-21-30)24-48-34-38-36-32(40(34)28-10-4-1-5-11-28)14-8-3-9-15-33-37-39-35(41(33)29-12-6-2-7-13-29)49-25-27-18-22-31(23-19-27)43(46)47/h1-2,4-7,10-13,16-23H,3,8-9,14-15,24-25H2 |
| InChIKey | XDPSJHSHQKQAHO-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 147.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|