C34H30N8O4S2 — CID 14066214
3-[(2-nitrophenyl)methylsulfanyl]-5-[4-[5-[(2-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]butyl]-4-phenyl-1,2,4-triazole (PubChem CID 14066214) has the molecular formula C34H30N8O4S2 and a molecular weight of 678.80 g/mol. Its IUPAC name is 3-[(2-nitrophenyl)methylsulfanyl]-5-[4-[5-[(2-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]butyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-[(2-nitrophenyl)methylsulfanyl]-5-[4-[5-[(2-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]butyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 14066214 |
| Molecular Formula | C34H30N8O4S2 |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.18 |
| IUPAC Name | 3-[(2-nitrophenyl)methylsulfanyl]-5-[4-[5-[(2-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]butyl]-4-phenyl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccccc1CSc1nnc(CCCCc2nnc(SCc3ccccc3[N+](=O)[O-])n2-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C34H30N8O4S2/c43-41(44)29-19-9-7-13-25(29)23-47-33-37-35-31(39(33)27-15-3-1-4-16-27)21-11-12-22-32-36-38-34(40(32)28-17-5-2-6-18-28)48-24-26-14-8-10-20-30(26)42(45)46/h1-10,13-20H,11-12,21-24H2 |
| InChIKey | UVQAMIHEGCGYTB-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 147.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|