C15H12N4O2S — CID 42493442
3-[(2-nitrophenyl)methylsulfanyl]-1-phenyl-1,2,4-triazole (PubChem CID 42493442) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-[(2-nitrophenyl)methylsulfanyl]-1-phenyl-1,2,4-triazole.
| Compound Name | 3-[(2-nitrophenyl)methylsulfanyl]-1-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 42493442 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-[(2-nitrophenyl)methylsulfanyl]-1-phenyl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccccc1CSc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H12N4O2S/c20-19(21)14-9-5-4-6-12(14)10-22-15-16-11-18(17-15)13-7-2-1-3-8-13/h1-9,11H,10H2 |
| InChIKey | IYIPAKJLIVVACZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|