C20H13N5O4S2 — CID 5048863
3,5-bis[(2-nitrophenyl)sulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 5048863) has the molecular formula C20H13N5O4S2 and a molecular weight of 451.49 g/mol. Its IUPAC name is 3,5-bis[(2-nitrophenyl)sulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3,5-bis[(2-nitrophenyl)sulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 5048863 |
| Molecular Formula | C20H13N5O4S2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3,5-bis[(2-nitrophenyl)sulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccccc1Sc1nnc(Sc2ccccc2[N+](=O)[O-])n1-c1ccccc1 |
| InChI | InChI=1S/C20H13N5O4S2/c26-24(27)15-10-4-6-12-17(15)30-19-21-22-20(23(19)14-8-2-1-3-9-14)31-18-13-7-5-11-16(18)25(28)29/h1-13H |
| InChIKey | JRZHXTBWTGWNJL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|