C29H27N5O2S2 — CID 170864632
1-[4-[[5-(naphthalen-1-ylmethylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propan-2-amine (PubChem CID 170864632) has the molecular formula C29H27N5O2S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 1-[4-[[5-(naphthalen-1-ylmethylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propan-2-amine.
| Compound Name | 1-[4-[[5-(naphthalen-1-ylmethylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propan-2-amine |
|---|---|
| PubChem CID | 170864632 |
| Molecular Formula | C29H27N5O2S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 1-[4-[[5-(naphthalen-1-ylmethylsulfanylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(Sc2nnc(CSCc3cccc4ccccc34)n2-c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27N5O2S2/c1-20(30)16-21-14-15-27(26(17-21)34(35)36)38-29-32-31-28(33(29)24-11-3-2-4-12-24)19-37-18-23-10-7-9-22-8-5-6-13-25(22)23/h2-15,17,20H,16,18-19,30H2,1H3 |
| InChIKey | SNLJGXVZOPITEV-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|