C26H18N6O5S2 — CID 124530222
5-[[3-nitro-4-[[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124530222) has the molecular formula C26H18N6O5S2 and a molecular weight of 558.60 g/mol. Its IUPAC name is 5-[[3-nitro-4-[[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3-nitro-4-[[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124530222 |
| Molecular Formula | C26H18N6O5S2 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 5-[[3-nitro-4-[[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccc(Sc2nnc(COc3ccccc3)n2-c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H18N6O5S2/c33-23-19(24(34)28-25(38)27-23)13-16-11-12-21(20(14-16)32(35)36)39-26-30-29-22(15-37-18-9-5-2-6-10-18)31(26)17-7-3-1-4-8-17/h1-14H,15H2,(H2,27,28,33,34,38) |
| InChIKey | CGSKATNNDWQXLP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|