C34H23N5O3S — CID 124529992
1-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-dibenzofuran-3-ylmethanimine (PubChem CID 124529992) has the molecular formula C34H23N5O3S and a molecular weight of 581.66 g/mol. Its IUPAC name is 1-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-dibenzofuran-3-ylmethanimine.
| Compound Name | 1-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-dibenzofuran-3-ylmethanimine |
|---|---|
| PubChem CID | 124529992 |
| Molecular Formula | C34H23N5O3S |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 1-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-dibenzofuran-3-ylmethanimine |
| SMILES | O=[N+]([O-])c1cc(/C=N/c2ccc3c(c2)oc2ccccc23)ccc1Sc1nnc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C34H23N5O3S/c40-39(41)29-19-24(22-35-25-16-17-28-27-13-7-8-14-30(27)42-31(28)21-25)15-18-32(29)43-34-37-36-33(20-23-9-3-1-4-10-23)38(34)26-11-5-2-6-12-26/h1-19,21-22H,20H2/b35-22+ |
| InChIKey | NHQODFSHERFCCY-FADJLKOXSA-N |
| XLogP | 8.57 |
| TPSA | 99.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|