C28H18N6O4S — CID 2721148
N-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide (PubChem CID 2721148) has the molecular formula C28H18N6O4S and a molecular weight of 534.56 g/mol. Its IUPAC name is N-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide.
| Compound Name | N-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2721148 |
| Molecular Formula | C28H18N6O4S |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | N-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Sc2n[nH]c(-c3ccccc3)n2)c([N+](=O)[O-])c1)c1cc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C28H18N6O4S/c35-27(24-15-21-20-9-5-4-6-18(20)11-12-23(21)38-24)32-29-16-17-10-13-25(22(14-17)34(36)37)39-28-30-26(31-33-28)19-7-2-1-3-8-19/h1-16H,(H,32,35)(H,30,31,33) |
| InChIKey | JPGUODKVCBINRX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|