C23H16Cl2N6O4S — CID 126199910
2-(2,4-dichlorophenoxy)-N-[(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]acetamide (PubChem CID 126199910) has the molecular formula C23H16Cl2N6O4S and a molecular weight of 543.39 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126199910 |
| Molecular Formula | C23H16Cl2N6O4S |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C\c1ccc(Sc2n[nH]c(-c3ccccc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16Cl2N6O4S/c24-16-7-8-19(17(25)11-16)35-13-21(32)28-26-12-14-6-9-20(18(10-14)31(33)34)36-23-27-22(29-30-23)15-4-2-1-3-5-15/h1-12H,13H2,(H,28,32)(H,27,29,30)/b26-12- |
| InChIKey | LDSRILDQDMFMJY-ZRGSRPPYSA-N |
| XLogP | 5.37 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|