C22H14Cl2N6O3S — CID 126196239
N-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]benzamide (PubChem CID 126196239) has the molecular formula C22H14Cl2N6O3S and a molecular weight of 513.37 g/mol. Its IUPAC name is N-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]benzamide.
| Compound Name | N-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126196239 |
| Molecular Formula | C22H14Cl2N6O3S |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | N-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Sc2n[nH]c(-c3ccc(Cl)cc3Cl)n2)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C22H14Cl2N6O3S/c23-15-7-8-16(17(24)11-15)20-26-22(29-27-20)34-19-9-6-13(10-18(19)30(32)33)12-25-28-21(31)14-4-2-1-3-5-14/h1-12H,(H,28,31)(H,26,27,29)/b25-12- |
| InChIKey | PNJPPFUCIWKKPD-ROTLSHHCSA-N |
| XLogP | 5.60 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|