C16H11ClN4O4S — CID 8714499
4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzaldehyde (PubChem CID 8714499) has the molecular formula C16H11ClN4O4S and a molecular weight of 390.81 g/mol. Its IUPAC name is 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzaldehyde.
| Compound Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 8714499 |
| Molecular Formula | C16H11ClN4O4S |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzaldehyde |
| SMILES | COc1ccc(Cl)cc1-c1nc(Sc2ccc(C=O)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C16H11ClN4O4S/c1-25-13-4-3-10(17)7-11(13)15-18-16(20-19-15)26-14-5-2-9(8-22)6-12(14)21(23)24/h2-8H,1H3,(H,18,19,20) |
| InChIKey | QIEYEVRVHOUKHM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|