C15H16ClN3O4S — CID 58948854
ethyl 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate (PubChem CID 58948854) has the molecular formula C15H16ClN3O4S and a molecular weight of 369.83 g/mol. Its IUPAC name is ethyl 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 58948854 |
| Molecular Formula | C15H16ClN3O4S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | ethyl 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1n[nH]c(-c2cc(Cl)ccc2OC)n1 |
| InChI | InChI=1S/C15H16ClN3O4S/c1-3-23-13(21)7-10(20)8-24-15-17-14(18-19-15)11-6-9(16)4-5-12(11)22-2/h4-6H,3,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | SAGOYVOYHSVMGT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|