C19H27ClN4O2S — CID 8806899
2-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2R)-octan-2-yl]acetamide (PubChem CID 8806899) has the molecular formula C19H27ClN4O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is 2-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2R)-octan-2-yl]acetamide.
| Compound Name | 2-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2R)-octan-2-yl]acetamide |
|---|---|
| PubChem CID | 8806899 |
| Molecular Formula | C19H27ClN4O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2R)-octan-2-yl]acetamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)CSc1n[nH]c(-c2cc(Cl)ccc2OC)n1 |
| InChI | InChI=1S/C19H27ClN4O2S/c1-4-5-6-7-8-13(2)21-17(25)12-27-19-22-18(23-24-19)15-11-14(20)9-10-16(15)26-3/h9-11,13H,4-8,12H2,1-3H3,(H,21,25)(H,22,23,24)/t13-/m1/s1 |
| InChIKey | PWNNKSKQGRVXNK-CYBMUJFWSA-N |
| XLogP | 4.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|