C27H20N4O6 — CID 126217803
N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide (PubChem CID 126217803) has the molecular formula C27H20N4O6 and a molecular weight of 496.48 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126217803 |
| Molecular Formula | C27H20N4O6 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc3c(ccc4ccccc43)o2)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C27H20N4O6/c1-2-35-24-13-17(7-10-23(24)37-26-12-9-19(16-28-26)31(33)34)15-29-30-27(32)25-14-21-20-6-4-3-5-18(20)8-11-22(21)36-25/h3-16H,2H2,1H3,(H,30,32)/b29-15+ |
| InChIKey | LXIMYJXAJABEMT-WKULSOCRSA-N |
| XLogP | 5.84 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|