C27H33N9O4 — CID 126205804
N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 126205804) has the molecular formula C27H33N9O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 126205804 |
| Molecular Formula | C27H33N9O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1cc(/C=N/Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C27H33N9O4/c1-2-39-23-17-20(9-11-22(23)40-24-12-10-21(19-28-24)36(37)38)18-29-33-25-30-26(34-13-5-3-6-14-34)32-27(31-25)35-15-7-4-8-16-35/h9-12,17-19H,2-8,13-16H2,1H3,(H,30,31,32,33)/b29-18+ |
| InChIKey | PEQQMGKAEYCWRK-RDRPBHBLSA-N |
| XLogP | 4.79 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|