C27H30N8O7 — CID 124544758
[4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate (PubChem CID 124544758) has the molecular formula C27H30N8O7 and a molecular weight of 578.59 g/mol. Its IUPAC name is [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 124544758 |
| Molecular Formula | C27H30N8O7 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-nitrobenzoate |
| SMILES | CCOc1cc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H30N8O7/c1-2-41-23-17-19(3-8-22(23)42-24(36)20-4-6-21(7-5-20)35(37)38)18-28-32-25-29-26(33-9-13-39-14-10-33)31-27(30-25)34-11-15-40-16-12-34/h3-8,17-18H,2,9-16H2,1H3,(H,29,30,31,32)/b28-18- |
| InChIKey | CGYNVNCFHXBTNE-VEILYXNESA-N |
| XLogP | 2.52 |
| TPSA | 166.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|