C25H26N8O6 — CID 124529711
[3-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 124529711) has the molecular formula C25H26N8O6 and a molecular weight of 534.53 g/mol. Its IUPAC name is [3-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [3-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 124529711 |
| Molecular Formula | C25H26N8O6 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | [3-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | O=C(Oc1cccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26N8O6/c34-22(19-4-2-5-20(16-19)33(35)36)39-21-6-1-3-18(15-21)17-26-30-23-27-24(31-7-11-37-12-8-31)29-25(28-23)32-9-13-38-14-10-32/h1-6,15-17H,7-14H2,(H,27,28,29,30)/b26-17- |
| InChIKey | XRVXVCKZYZQQIS-ONUIUJJFSA-N |
| XLogP | 2.12 |
| TPSA | 157.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|