C27H29N9O6 — CID 56698622
[3-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 56698622) has the molecular formula C27H29N9O6 and a molecular weight of 575.59 g/mol. Its IUPAC name is [3-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [3-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 56698622 |
| Molecular Formula | C27H29N9O6 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | [3-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | O=C(Oc1cccc(/C=N/Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H29N9O6/c37-24(20-15-21(35(38)39)17-22(16-20)36(40)41)42-23-9-7-8-19(14-23)18-28-32-25-29-26(33-10-3-1-4-11-33)31-27(30-25)34-12-5-2-6-13-34/h7-9,14-18H,1-6,10-13H2,(H,29,30,31,32)/b28-18+ |
| InChIKey | UHPDWELUOUKDPA-MTDXEUNCSA-N |
| XLogP | 4.33 |
| TPSA | 182.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|