C21H22ClN9O2 — CID 6229210
2-N-[(Z)-(3-chlorophenyl)methylideneamino]-6-(4-methylpiperazin-1-yl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 6229210) has the molecular formula C21H22ClN9O2 and a molecular weight of 467.92 g/mol. Its IUPAC name is 2-N-[(Z)-(3-chlorophenyl)methylideneamino]-6-(4-methylpiperazin-1-yl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-(3-chlorophenyl)methylideneamino]-6-(4-methylpiperazin-1-yl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6229210 |
| Molecular Formula | C21H22ClN9O2 |
| Molecular Weight | 467.92 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-N-[(Z)-(3-chlorophenyl)methylideneamino]-6-(4-methylpiperazin-1-yl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN1CCN(c2nc(N/N=C\c3cccc(Cl)c3)nc(Nc3ccc([N+](=O)[O-])cc3)n2)CC1 |
| InChI | InChI=1S/C21H22ClN9O2/c1-29-9-11-30(12-10-29)21-26-19(24-17-5-7-18(8-6-17)31(32)33)25-20(27-21)28-23-14-15-3-2-4-16(22)13-15/h2-8,13-14H,9-12H2,1H3,(H2,24,25,26,27,28)/b23-14- |
| InChIKey | NMXXHQBFGGZPAO-UCQKPKSFSA-N |
| XLogP | 3.37 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.92 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|