C29H28ClN9O3 — CID 138469737
1-(4-chlorophenyl)-3-[4-[[4-(4-methylpiperazin-1-yl)-6-[(E)-2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea (PubChem CID 138469737) has the molecular formula C29H28ClN9O3 and a molecular weight of 586.06 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[[4-(4-methylpiperazin-1-yl)-6-[(E)-2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[[4-(4-methylpiperazin-1-yl)-6-[(E)-2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 138469737 |
| Molecular Formula | C29H28ClN9O3 |
| Molecular Weight | 586.06 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[[4-(4-methylpiperazin-1-yl)-6-[(E)-2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea |
| SMILES | CN1CCN(c2nc(/C=C/c3cccc([N+](=O)[O-])c3)nc(Nc3ccc(NC(=O)Nc4ccc(Cl)cc4)cc3)n2)CC1 |
| InChI | InChI=1S/C29H28ClN9O3/c1-37-15-17-38(18-16-37)28-35-26(14-5-20-3-2-4-25(19-20)39(41)42)34-27(36-28)31-22-10-12-24(13-11-22)33-29(40)32-23-8-6-21(30)7-9-23/h2-14,19H,15-18H2,1H3,(H2,32,33,40)(H,31,34,35,36)/b14-5+ |
| InChIKey | CIYCHIXAEULMGX-LHHJGKSTSA-N |
| XLogP | 5.74 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|