C16H18N6O2 — CID 175736488
2-(4-methylpiperazin-1-yl)-4-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazine (PubChem CID 175736488) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-4-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-4-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 175736488 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-4-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazine |
| SMILES | CN1CCN(c2ncnc(C=Cc3cccc([N+](=O)[O-])c3)n2)CC1 |
| InChI | InChI=1S/C16H18N6O2/c1-20-7-9-21(10-8-20)16-18-12-17-15(19-16)6-5-13-3-2-4-14(11-13)22(23)24/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | WXYOGJGVHLQHDT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|