C27H23ClN8O4 — CID 175222137
1-(4-chlorophenyl)-3-[4-[[4-(3-hydroxyazetidin-1-yl)-6-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea (PubChem CID 175222137) has the molecular formula C27H23ClN8O4 and a molecular weight of 558.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[[4-(3-hydroxyazetidin-1-yl)-6-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[[4-(3-hydroxyazetidin-1-yl)-6-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 175222137 |
| Molecular Formula | C27H23ClN8O4 |
| Molecular Weight | 558.99 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[[4-(3-hydroxyazetidin-1-yl)-6-[2-(3-nitrophenyl)ethenyl]-1,3,5-triazin-2-yl]amino]phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(Nc2nc(C=Cc3cccc([N+](=O)[O-])c3)nc(N3CC(O)C3)n2)cc1 |
| InChI | InChI=1S/C27H23ClN8O4/c28-18-5-7-20(8-6-18)30-27(38)31-21-11-9-19(10-12-21)29-25-32-24(33-26(34-25)35-15-23(37)16-35)13-4-17-2-1-3-22(14-17)36(39)40/h1-14,23,37H,15-16H2,(H2,30,31,38)(H,29,32,33,34) |
| InChIKey | PLUFCDKZJSBUCF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.99 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|