C25H21N3O8 — CID 6300880
[4-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-nitrobenzoate (PubChem CID 6300880) has the molecular formula C25H21N3O8 and a molecular weight of 491.46 g/mol. Its IUPAC name is [4-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6300880 |
| Molecular Formula | C25H21N3O8 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | [4-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-nitrobenzoate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc3c(c2)OCCO3)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H21N3O8/c1-2-33-22-13-16(3-9-21(22)36-25(30)17-4-7-19(8-5-17)28(31)32)15-26-27-24(29)18-6-10-20-23(14-18)35-12-11-34-20/h3-10,13-15H,2,11-12H2,1H3,(H,27,29)/b26-15- |
| InChIKey | HTQMHONCMOVXLQ-YSMPRRRNSA-N |
| XLogP | 3.75 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|