C30H22N4O2S — CID 126123220
1-[4-(4,6-diphenylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(4-methylphenyl)methanimine (PubChem CID 126123220) has the molecular formula C30H22N4O2S and a molecular weight of 502.60 g/mol. Its IUPAC name is 1-[4-(4,6-diphenylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(4-methylphenyl)methanimine.
| Compound Name | 1-[4-(4,6-diphenylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126123220 |
| Molecular Formula | C30H22N4O2S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-[4-(4,6-diphenylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(4-methylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2ccc(Sc3nc(-c4ccccc4)cc(-c4ccccc4)n3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H22N4O2S/c1-21-12-15-25(16-13-21)31-20-22-14-17-29(28(18-22)34(35)36)37-30-32-26(23-8-4-2-5-9-23)19-27(33-30)24-10-6-3-7-11-24/h2-20H,1H3/b31-20+ |
| InChIKey | MPPHSOJPZGLGON-AJBULDERSA-N |
| XLogP | 7.93 |
| TPSA | 81.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|