C28H17N5O3S — CID 126116042
2-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 126116042) has the molecular formula C28H17N5O3S and a molecular weight of 503.54 g/mol. Its IUPAC name is 2-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 126116042 |
| Molecular Formula | C28H17N5O3S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 2-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2ccc(Sc3ncccn3)c([N+](=O)[O-])c2)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H17N5O3S/c29-17-22-25(20-8-3-1-4-9-20)26(21-10-5-2-6-11-21)36-27(22)32-18-19-12-13-24(23(16-19)33(34)35)37-28-30-14-7-15-31-28/h1-16,18H |
| InChIKey | JTAGUZLEVSCWSC-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 118.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|