C30H21N3O4 — CID 126346862
4,5-bis(4-methylphenyl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile (PubChem CID 126346862) has the molecular formula C30H21N3O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is 4,5-bis(4-methylphenyl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(4-methylphenyl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 126346862 |
| Molecular Formula | C30H21N3O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4,5-bis(4-methylphenyl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile |
| SMILES | Cc1ccc(-c2oc(N=Cc3ccc(-c4ccccc4[N+](=O)[O-])o3)c(C#N)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H21N3O4/c1-19-7-11-21(12-8-19)28-25(17-31)30(37-29(28)22-13-9-20(2)10-14-22)32-18-23-15-16-27(36-23)24-5-3-4-6-26(24)33(34)35/h3-16,18H,1-2H3 |
| InChIKey | APBJLTKDLWNBJU-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 105.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|