C32H24N2O4 — CID 126349774
methyl 3-[5-[[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 126349774) has the molecular formula C32H24N2O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is methyl 3-[5-[[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | methyl 3-[5-[[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126349774 |
| Molecular Formula | C32H24N2O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | methyl 3-[5-[[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(C=Nc3oc(-c4ccc(C)cc4)c(-c4ccc(C)cc4)c3C#N)o2)c1 |
| InChI | InChI=1S/C32H24N2O4/c1-20-7-11-22(12-8-20)29-27(18-33)31(38-30(29)23-13-9-21(2)10-14-23)34-19-26-15-16-28(37-26)24-5-4-6-25(17-24)32(35)36-3/h4-17,19H,1-3H3 |
| InChIKey | FJDGTSLUGADOIT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 88.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|