C30H20Cl2N2O2 — CID 126357947
2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile (PubChem CID 126357947) has the molecular formula C30H20Cl2N2O2 and a molecular weight of 511.41 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126357947 |
| Molecular Formula | C30H20Cl2N2O2 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| SMILES | Cc1ccc(-c2oc(N=Cc3ccc(-c4ccc(Cl)cc4Cl)o3)c(C#N)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H20Cl2N2O2/c1-18-3-7-20(8-4-18)28-25(16-33)30(36-29(28)21-9-5-19(2)6-10-21)34-17-23-12-14-27(35-23)24-13-11-22(31)15-26(24)32/h3-15,17H,1-2H3 |
| InChIKey | VADCNWYZZFCLGH-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 62.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|