C35H25Cl2N3O — CID 126370549
2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile (PubChem CID 126370549) has the molecular formula C35H25Cl2N3O and a molecular weight of 574.51 g/mol. Its IUPAC name is 2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile.
| Compound Name | 2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126370549 |
| Molecular Formula | C35H25Cl2N3O |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| SMILES | Cc1ccc(-c2oc(N=Cc3cn(Cc4ccc(Cl)cc4Cl)c4ccccc34)c(C#N)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H25Cl2N3O/c1-22-7-11-24(12-8-22)33-30(18-38)35(41-34(33)25-13-9-23(2)10-14-25)39-19-27-21-40(32-6-4-3-5-29(27)32)20-26-15-16-28(36)17-31(26)37/h3-17,19,21H,20H2,1-2H3 |
| InChIKey | YULPNCYWUIMLHT-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|