C29H17Cl2N3O3 — CID 126392585
2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile (PubChem CID 126392585) has the molecular formula C29H17Cl2N3O3 and a molecular weight of 526.38 g/mol. Its IUPAC name is 2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile.
| Compound Name | 2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126392585 |
| Molecular Formula | C29H17Cl2N3O3 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | 2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)oc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C29H17Cl2N3O3/c30-22-10-9-18(13-23(22)31)16-34-17-19(20-5-1-2-6-24(20)34)15-33-29-21(14-32)27(25-7-3-11-35-25)28(37-29)26-8-4-12-36-26/h1-13,15,17H,16H2 |
| InChIKey | SVRHXWZMTODFBO-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 80.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|