C27H14Cl2I2N2O4 — CID 126387863
2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile (PubChem CID 126387863) has the molecular formula C27H14Cl2I2N2O4 and a molecular weight of 755.13 g/mol. Its IUPAC name is 2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile.
| Compound Name | 2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126387863 |
| Molecular Formula | C27H14Cl2I2N2O4 |
| Molecular Weight | 755.13 g/mol |
| Exact Mass | 753.84 |
| IUPAC Name | 2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cc(I)c(OCc3ccc(Cl)cc3Cl)c(I)c2)oc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C27H14Cl2I2N2O4/c28-17-6-5-16(19(29)11-17)14-36-25-20(30)9-15(10-21(25)31)13-33-27-18(12-32)24(22-3-1-7-34-22)26(37-27)23-4-2-8-35-23/h1-11,13H,14H2 |
| InChIKey | TXQIVSDJMWXVLU-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 84.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.13 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|