C24H13N3O6 — CID 126384701
4,5-bis(furan-2-yl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile (PubChem CID 126384701) has the molecular formula C24H13N3O6 and a molecular weight of 439.38 g/mol. Its IUPAC name is 4,5-bis(furan-2-yl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(furan-2-yl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 126384701 |
| Molecular Formula | C24H13N3O6 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 4,5-bis(furan-2-yl)-2-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]furan-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2ccc(-c3ccccc3[N+](=O)[O-])o2)oc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C24H13N3O6/c25-13-17-22(20-7-3-11-30-20)23(21-8-4-12-31-21)33-24(17)26-14-15-9-10-19(32-15)16-5-1-2-6-18(16)27(28)29/h1-12,14H |
| InChIKey | IMOAKUYJXTYAOJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 131.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|