C21H14N2O4 — CID 1286677
4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]furan-3-carbonitrile (PubChem CID 1286677) has the molecular formula C21H14N2O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 1286677 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-methylphenyl)methylideneamino]furan-3-carbonitrile |
| SMILES | Cc1ccc(O)c(C=Nc2oc(-c3ccco3)c(-c3ccco3)c2C#N)c1 |
| InChI | InChI=1S/C21H14N2O4/c1-13-6-7-16(24)14(10-13)12-23-21-15(11-22)19(17-4-2-8-25-17)20(27-21)18-5-3-9-26-18/h2-10,12,24H,1H3 |
| InChIKey | AHGUBYTXFZGAIO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|